C12H23N — CID 161291459
4,5-di(propan-2-yl)-3H-pyrrole;ethane (PubChem CID 161291459) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 4,5-di(propan-2-yl)-3H-pyrrole;ethane.
| Compound Name | 4,5-di(propan-2-yl)-3H-pyrrole;ethane |
|---|---|
| PubChem CID | 161291459 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 4,5-di(propan-2-yl)-3H-pyrrole;ethane |
| SMILES | CC.CC(C)C1=C(C(C)C)N=CC1 |
| InChI | InChI=1S/C10H17N.C2H6/c1-7(2)9-5-6-11-10(9)8(3)4;1-2/h6-8H,5H2,1-4H3;1-2H3 |
| InChIKey | VGKBETCTJRLVFD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |