C13H10N2S — CID 22414455
4-thiophen-2-yl-3H-1,3-benzodiazepine (PubChem CID 22414455) has the molecular formula C13H10N2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 4-thiophen-2-yl-3H-1,3-benzodiazepine.
| Compound Name | 4-thiophen-2-yl-3H-1,3-benzodiazepine |
|---|---|
| PubChem CID | 22414455 |
| Molecular Formula | C13H10N2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 4-thiophen-2-yl-3H-1,3-benzodiazepine |
| SMILES | C1=Nc2ccccc2C=C(c2cccs2)N1 |
| InChI | InChI=1S/C13H10N2S/c1-2-5-11-10(4-1)8-12(15-9-14-11)13-6-3-7-16-13/h1-9H,(H,14,15) |
| InChIKey | KNVIERWHJQBMFS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |