C15H21N — CID 57293485
3,3-dipropyl-4H-quinoline (PubChem CID 57293485) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 3,3-dipropyl-4H-quinoline.
| Compound Name | 3,3-dipropyl-4H-quinoline |
|---|---|
| PubChem CID | 57293485 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 3,3-dipropyl-4H-quinoline |
| SMILES | CCCC1(CCC)C=Nc2ccccc2C1 |
| InChI | InChI=1S/C15H21N/c1-3-9-15(10-4-2)11-13-7-5-6-8-14(13)16-12-15/h5-8,12H,3-4,9-11H2,1-2H3 |
| InChIKey | SDMVXJNUSHGECY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |