About 4H-3λ4,1-benzothiazine 3-oxide
4H-3λ4,1-benzothiazine 3-oxide (PubChem CID 158234889) has the molecular formula C8H7NOS
and a molecular weight of 165.22 g/mol. Its IUPAC name is 4H-3λ4,1-benzothiazine 3-oxide.
Molecular Properties
| Compound Name | 4H-3λ4,1-benzothiazine 3-oxide |
| PubChem CID | 158234889 |
| Molecular Formula | C8H7NOS |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | 4H-3λ4,1-benzothiazine 3-oxide |
| SMILES | O=S1C=Nc2ccccc2C1 |
| InChI | InChI=1S/C8H7NOS/c10-11-5-7-3-1-2-4-8(7)9-6-11/h1-4,6H,5H2 |
| InChIKey | GEVMGXAZSUGAQC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4H-3λ4,1-benzothiazine 3-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-3λ4,1-benzothiazine 3-oxide?
The IUPAC name of 4H-3λ4,1-benzothiazine 3-oxide (CID 158234889) is 4H-3λ4,1-benzothiazine 3-oxide.
What is the SMILES notation for 4H-3λ4,1-benzothiazine 3-oxide?
The canonical SMILES for 4H-3λ4,1-benzothiazine 3-oxide is O=S1C=Nc2ccccc2C1.
What is the InChIKey of 4H-3λ4,1-benzothiazine 3-oxide?
The InChIKey is GEVMGXAZSUGAQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NOS/c10-11-5-7-3-1-2-4-8(7)9-6-11/h1-4,6H,5H2.
What are the key properties of 4H-3λ4,1-benzothiazine 3-oxide?
4H-3λ4,1-benzothiazine 3-oxide has a molecular weight of 165.22 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-3λ4,1-benzothiazine 3-oxide is sourced from PubChem (CID 158234889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).