About 3H-indazole;methane
3H-indazole;methane (PubChem CID 161379696) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 3H-indazole;methane.
Molecular Properties
| Compound Name | 3H-indazole;methane |
| PubChem CID | 161379696 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 3H-indazole;methane |
| SMILES | C.C.C.c1ccc2c(c1)CN=N2 |
| InChI | InChI=1S/C7H6N2.3CH4/c1-2-4-7-6(3-1)5-8-9-7;;;/h1-4H,5H2;3*1H4 |
| InChIKey | VROFINXQGJHAOD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3H-indazole;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-indazole;methane?
The IUPAC name of 3H-indazole;methane (CID 161379696) is 3H-indazole;methane.
What is the SMILES notation for 3H-indazole;methane?
The canonical SMILES for 3H-indazole;methane is C.C.C.c1ccc2c(c1)CN=N2.
What is the InChIKey of 3H-indazole;methane?
The InChIKey is VROFINXQGJHAOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.3CH4/c1-2-4-7-6(3-1)5-8-9-7;;;/h1-4H,5H2;3*1H4.
What are the key properties of 3H-indazole;methane?
3H-indazole;methane has a molecular weight of 166.27 g/mol, XLogP of 4.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-indazole;methane is sourced from PubChem (CID 161379696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).