C9H8N2O3S — CID 87558965
5H-1,2-benzodiazepine-4-sulfonic acid (PubChem CID 87558965) has the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. Its IUPAC name is 5H-1,2-benzodiazepine-4-sulfonic acid.
| Compound Name | 5H-1,2-benzodiazepine-4-sulfonic acid |
|---|---|
| PubChem CID | 87558965 |
| Molecular Formula | C9H8N2O3S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 5H-1,2-benzodiazepine-4-sulfonic acid |
| SMILES | O=S(=O)(O)C1=CN=Nc2ccccc2C1 |
| InChI | InChI=1S/C9H8N2O3S/c12-15(13,14)8-5-7-3-1-2-4-9(7)11-10-6-8/h1-4,6H,5H2,(H,12,13,14) |
| InChIKey | KYWUXQHCEMYFQN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|