About acetic acid;2-methyl-3H-indole
acetic acid;2-methyl-3H-indole (PubChem CID 123241059) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is acetic acid;2-methyl-3H-indole.
Molecular Properties
| Compound Name | acetic acid;2-methyl-3H-indole |
| PubChem CID | 123241059 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | acetic acid;2-methyl-3H-indole |
| SMILES | CC(=O)O.CC1=Nc2ccccc2C1 |
| InChI | InChI=1S/C9H9N.C2H4O2/c1-7-6-8-4-2-3-5-9(8)10-7;1-2(3)4/h2-5H,6H2,1H3;1H3,(H,3,4) |
| InChIKey | VAKIMJANZWDDIU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetic acid;2-methyl-3H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-methyl-3H-indole?
The IUPAC name of acetic acid;2-methyl-3H-indole (CID 123241059) is acetic acid;2-methyl-3H-indole.
What is the SMILES notation for acetic acid;2-methyl-3H-indole?
The canonical SMILES for acetic acid;2-methyl-3H-indole is CC(=O)O.CC1=Nc2ccccc2C1.
What is the InChIKey of acetic acid;2-methyl-3H-indole?
The InChIKey is VAKIMJANZWDDIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C2H4O2/c1-7-6-8-4-2-3-5-9(8)10-7;1-2(3)4/h2-5H,6H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;2-methyl-3H-indole?
acetic acid;2-methyl-3H-indole has a molecular weight of 191.23 g/mol, XLogP of 2.43, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-methyl-3H-indole is sourced from PubChem (CID 123241059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).