C11H17ClN2O2 — CID 18526934
2,4-dimethyl-3H-1,5-benzodiazepine;dihydrate;hydrochloride (PubChem CID 18526934) has the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. Its IUPAC name is 2,4-dimethyl-3H-1,5-benzodiazepine;dihydrate;hydrochloride.
| Compound Name | 2,4-dimethyl-3H-1,5-benzodiazepine;dihydrate;hydrochloride |
|---|---|
| PubChem CID | 18526934 |
| Molecular Formula | C11H17ClN2O2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2,4-dimethyl-3H-1,5-benzodiazepine;dihydrate;hydrochloride |
| SMILES | CC1=Nc2ccccc2N=C(C)C1.Cl.O.O |
| InChI | InChI=1S/C11H12N2.ClH.2H2O/c1-8-7-9(2)13-11-6-4-3-5-10(11)12-8;;;/h3-6H,7H2,1-2H3;1H;2*1H2 |
| InChIKey | YNZCLCYJIJPOJZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |