About 3H-indole-2-carbonitrile
3H-indole-2-carbonitrile (PubChem CID 66725406) has the molecular formula C9H6N2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 3H-indole-2-carbonitrile.
Molecular Properties
| Compound Name | 3H-indole-2-carbonitrile |
| PubChem CID | 66725406 |
| Molecular Formula | C9H6N2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | 3H-indole-2-carbonitrile |
| SMILES | N#CC1=Nc2ccccc2C1 |
| InChI | InChI=1S/C9H6N2/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-4H,5H2 |
| InChIKey | GALGYFBCCIASIY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3H-indole-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-indole-2-carbonitrile?
The IUPAC name of 3H-indole-2-carbonitrile (CID 66725406) is 3H-indole-2-carbonitrile.
What is the SMILES notation for 3H-indole-2-carbonitrile?
The canonical SMILES for 3H-indole-2-carbonitrile is N#CC1=Nc2ccccc2C1.
What is the InChIKey of 3H-indole-2-carbonitrile?
The InChIKey is GALGYFBCCIASIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-4H,5H2.
What are the key properties of 3H-indole-2-carbonitrile?
3H-indole-2-carbonitrile has a molecular weight of 142.16 g/mol, XLogP of 1.84, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-indole-2-carbonitrile is sourced from PubChem (CID 66725406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).