About 7-iodo-3H-indole
7-iodo-3H-indole (PubChem CID 156577348) has the molecular formula C8H6IN
and a molecular weight of 243.05 g/mol. Its IUPAC name is 7-iodo-3H-indole.
Molecular Properties
| Compound Name | 7-iodo-3H-indole |
| PubChem CID | 156577348 |
| Molecular Formula | C8H6IN |
| Molecular Weight | 243.05 g/mol |
| Exact Mass | 242.95 |
| IUPAC Name | 7-iodo-3H-indole |
| SMILES | Ic1cccc2c1N=CC2 |
| InChI | InChI=1S/C8H6IN/c9-7-3-1-2-6-4-5-10-8(6)7/h1-3,5H,4H2 |
| InChIKey | KQGWGLJNQZDMKH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.05 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-3H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-3H-indole?
The IUPAC name of 7-iodo-3H-indole (CID 156577348) is 7-iodo-3H-indole.
What is the SMILES notation for 7-iodo-3H-indole?
The canonical SMILES for 7-iodo-3H-indole is Ic1cccc2c1N=CC2.
What is the InChIKey of 7-iodo-3H-indole?
The InChIKey is KQGWGLJNQZDMKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6IN/c9-7-3-1-2-6-4-5-10-8(6)7/h1-3,5H,4H2.
What are the key properties of 7-iodo-3H-indole?
7-iodo-3H-indole has a molecular weight of 243.05 g/mol, XLogP of 2.55, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-3H-indole is sourced from PubChem (CID 156577348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).