C8H7IO — CID 134256715
4-iodo-1,3-dihydro-2-benzofuran (PubChem CID 134256715) has the molecular formula C8H7IO and a molecular weight of 246.05 g/mol. Its IUPAC name is 4-iodo-1,3-dihydro-2-benzofuran.
| Compound Name | 4-iodo-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 134256715 |
| Molecular Formula | C8H7IO |
| Molecular Weight | 246.05 g/mol |
| Exact Mass | 245.95 |
| IUPAC Name | 4-iodo-1,3-dihydro-2-benzofuran |
| SMILES | Ic1cccc2c1COC2 |
| InChI | InChI=1S/C8H7IO/c9-8-3-1-2-6-4-10-5-7(6)8/h1-3H,4-5H2 |
| InChIKey | POIRLMICSRYSMX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.05 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|