C10H12IN — CID 131030686
(2S)-8-iodo-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 131030686) has the molecular formula C10H12IN and a molecular weight of 273.12 g/mol. Its IUPAC name is (2S)-8-iodo-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (2S)-8-iodo-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 131030686 |
| Molecular Formula | C10H12IN |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | (2S)-8-iodo-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | N[C@H]1CCc2cccc(I)c2C1 |
| InChI | InChI=1S/C10H12IN/c11-10-3-1-2-7-4-5-8(12)6-9(7)10/h1-3,8H,4-6,12H2/t8-/m0/s1 |
| InChIKey | KNGQWCQZJASKKZ-QMMMGPOBSA-N |
| XLogP | 2.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|