C11H14IN — CID 131076121
(2S)-7-iodo-6-methyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 131076121) has the molecular formula C11H14IN and a molecular weight of 287.14 g/mol. Its IUPAC name is (2S)-7-iodo-6-methyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (2S)-7-iodo-6-methyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 131076121 |
| Molecular Formula | C11H14IN |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | (2S)-7-iodo-6-methyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | Cc1cc2c(cc1I)C[C@@H](N)CC2 |
| InChI | InChI=1S/C11H14IN/c1-7-4-8-2-3-10(13)5-9(8)6-11(7)12/h4,6,10H,2-3,5,13H2,1H3/t10-/m0/s1 |
| InChIKey | BNJPHOKGFZPMFC-JTQLQIEISA-N |
| XLogP | 2.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|