C13H19N — CID 130000646
8-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 130000646) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 8-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 8-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 130000646 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 8-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CC(C)c1cccc2c1CC(N)CC2 |
| InChI | InChI=1S/C13H19N/c1-9(2)12-5-3-4-10-6-7-11(14)8-13(10)12/h3-5,9,11H,6-8,14H2,1-2H3 |
| InChIKey | YVJDPKPMOHNXNZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |