C13H18O2 — CID 156687185
5-propan-2-yl-1,2,3,4-tetrahydronaphthalene-2,3-diol (PubChem CID 156687185) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is 5-propan-2-yl-1,2,3,4-tetrahydronaphthalene-2,3-diol.
| Compound Name | 5-propan-2-yl-1,2,3,4-tetrahydronaphthalene-2,3-diol |
|---|---|
| PubChem CID | 156687185 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 5-propan-2-yl-1,2,3,4-tetrahydronaphthalene-2,3-diol |
| SMILES | CC(C)c1cccc2c1CC(O)C(O)C2 |
| InChI | InChI=1S/C13H18O2/c1-8(2)10-5-3-4-9-6-12(14)13(15)7-11(9)10/h3-5,8,12-15H,6-7H2,1-2H3 |
| InChIKey | JSYQIPKAIODCSS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |