C12H17NO — CID 175179853
[4-(1-aminoethyl)-2,3-dihydro-1H-inden-2-yl]methanol (PubChem CID 175179853) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is [4-(1-aminoethyl)-2,3-dihydro-1H-inden-2-yl]methanol.
| Compound Name | [4-(1-aminoethyl)-2,3-dihydro-1H-inden-2-yl]methanol |
|---|---|
| PubChem CID | 175179853 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | [4-(1-aminoethyl)-2,3-dihydro-1H-inden-2-yl]methanol |
| SMILES | CC(N)c1cccc2c1CC(CO)C2 |
| InChI | InChI=1S/C12H17NO/c1-8(13)11-4-2-3-10-5-9(7-14)6-12(10)11/h2-4,8-9,14H,5-7,13H2,1H3 |
| InChIKey | VBVMCQSKYQXYOE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |