C10H12O2 — CID 83674155
2-(1,3-dihydro-2-benzofuran-4-yl)ethanol (PubChem CID 83674155) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 2-(1,3-dihydro-2-benzofuran-4-yl)ethanol.
| Compound Name | 2-(1,3-dihydro-2-benzofuran-4-yl)ethanol |
|---|---|
| PubChem CID | 83674155 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2-(1,3-dihydro-2-benzofuran-4-yl)ethanol |
| SMILES | OCCc1cccc2c1COC2 |
| InChI | InChI=1S/C10H12O2/c11-5-4-8-2-1-3-9-6-12-7-10(8)9/h1-3,11H,4-7H2 |
| InChIKey | ZYPJUWKMAGIZRK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |