About 1-ethenyl-1,3-dihydro-2-benzofuran
1-ethenyl-1,3-dihydro-2-benzofuran (PubChem CID 11084023) has the molecular formula C10H10O
and a molecular weight of 146.19 g/mol. Its IUPAC name is 1-ethenyl-1,3-dihydro-2-benzofuran.
Molecular Properties
| Compound Name | 1-ethenyl-1,3-dihydro-2-benzofuran |
| PubChem CID | 11084023 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 1-ethenyl-1,3-dihydro-2-benzofuran |
| SMILES | C=CC1OCc2ccccc21 |
| InChI | InChI=1S/C10H10O/c1-2-10-9-6-4-3-5-8(9)7-11-10/h2-6,10H,1,7H2 |
| InChIKey | ILDNZTRIVHPVAU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-1,3-dihydro-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-1,3-dihydro-2-benzofuran?
The IUPAC name of 1-ethenyl-1,3-dihydro-2-benzofuran (CID 11084023) is 1-ethenyl-1,3-dihydro-2-benzofuran.
What is the SMILES notation for 1-ethenyl-1,3-dihydro-2-benzofuran?
The canonical SMILES for 1-ethenyl-1,3-dihydro-2-benzofuran is C=CC1OCc2ccccc21.
What is the InChIKey of 1-ethenyl-1,3-dihydro-2-benzofuran?
The InChIKey is ILDNZTRIVHPVAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O/c1-2-10-9-6-4-3-5-8(9)7-11-10/h2-6,10H,1,7H2.
What are the key properties of 1-ethenyl-1,3-dihydro-2-benzofuran?
1-ethenyl-1,3-dihydro-2-benzofuran has a molecular weight of 146.19 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-1,3-dihydro-2-benzofuran is sourced from PubChem (CID 11084023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).