C9H10O2 — CID 19809558
1,3-dihydro-2-benzofuran-5-ylmethanol (PubChem CID 19809558) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 1,3-dihydro-2-benzofuran-5-ylmethanol.
| Compound Name | 1,3-dihydro-2-benzofuran-5-ylmethanol |
|---|---|
| PubChem CID | 19809558 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 1,3-dihydro-2-benzofuran-5-ylmethanol |
| SMILES | OCc1ccc2c(c1)COC2 |
| InChI | InChI=1S/C9H10O2/c10-4-7-1-2-8-5-11-6-9(8)3-7/h1-3,10H,4-6H2 |
| InChIKey | VPKXUXMJVPZFBB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |