C11H16O2 — CID 595604
[3-(hydroxymethyl)-2,4,6-trimethylphenyl]methanol (PubChem CID 595604) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is [3-(hydroxymethyl)-2,4,6-trimethylphenyl]methanol.
| Compound Name | [3-(hydroxymethyl)-2,4,6-trimethylphenyl]methanol |
|---|---|
| PubChem CID | 595604 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | [3-(hydroxymethyl)-2,4,6-trimethylphenyl]methanol |
| SMILES | Cc1cc(C)c(CO)c(C)c1CO |
| InChI | InChI=1S/C11H16O2/c1-7-4-8(2)11(6-13)9(3)10(7)5-12/h4,12-13H,5-6H2,1-3H3 |
| InChIKey | NWAIYLFAGPKYBZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |