About 2-methyl-6-propan-2-yl-3H-indole;7-propan-2-yl-3H-indole
2-methyl-6-propan-2-yl-3H-indole;7-propan-2-yl-3H-indole (PubChem CID 177061562) has the molecular formula C23H28N2
and a molecular weight of 332.49 g/mol. Its IUPAC name is 2-methyl-6-propan-2-yl-3H-indole;7-propan-2-yl-3H-indole.
Molecular Properties
| Compound Name | 2-methyl-6-propan-2-yl-3H-indole;7-propan-2-yl-3H-indole |
| PubChem CID | 177061562 |
| Molecular Formula | C23H28N2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 2-methyl-6-propan-2-yl-3H-indole;7-propan-2-yl-3H-indole |
| SMILES | CC(C)c1cccc2c1N=CC2.CC1=Nc2cc(C(C)C)ccc2C1 |
| InChI | InChI=1S/C12H15N.C11H13N/c1-8(2)10-4-5-11-6-9(3)13-12(11)7-10;1-8(2)10-5-3-4-9-6-7-12-11(9)10/h4-5,7-8H,6H2,1-3H3;3-5,7-8H,6H2,1-2H3 |
| InChIKey | PEXAZUCKKMDBPZ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-6-propan-2-yl-3H-indole;7-propan-2-yl-3H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-propan-2-yl-3H-indole;7-propan-2-yl-3H-indole?
The IUPAC name of 2-methyl-6-propan-2-yl-3H-indole;7-propan-2-yl-3H-indole (CID 177061562) is 2-methyl-6-propan-2-yl-3H-indole;7-propan-2-yl-3H-indole.
What is the SMILES notation for 2-methyl-6-propan-2-yl-3H-indole;7-propan-2-yl-3H-indole?
The canonical SMILES for 2-methyl-6-propan-2-yl-3H-indole;7-propan-2-yl-3H-indole is CC(C)c1cccc2c1N=CC2.CC1=Nc2cc(C(C)C)ccc2C1.
What is the InChIKey of 2-methyl-6-propan-2-yl-3H-indole;7-propan-2-yl-3H-indole?
The InChIKey is PEXAZUCKKMDBPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N.C11H13N/c1-8(2)10-4-5-11-6-9(3)13-12(11)7-10;1-8(2)10-5-3-4-9-6-7-12-11(9)10/h4-5,7-8H,6H2,1-3H3;3-5,7-8H,6H2,1-2H3.
What are the key properties of 2-methyl-6-propan-2-yl-3H-indole;7-propan-2-yl-3H-indole?
2-methyl-6-propan-2-yl-3H-indole;7-propan-2-yl-3H-indole has a molecular weight of 332.49 g/mol, XLogP of 6.53, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-propan-2-yl-3H-indole;7-propan-2-yl-3H-indole is sourced from PubChem (CID 177061562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).