C11H14N2 — CID 166091073
6-propan-2-yl-1,2-dihydroquinoxaline (PubChem CID 166091073) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 6-propan-2-yl-1,2-dihydroquinoxaline.
| Compound Name | 6-propan-2-yl-1,2-dihydroquinoxaline |
|---|---|
| PubChem CID | 166091073 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 6-propan-2-yl-1,2-dihydroquinoxaline |
| SMILES | CC(C)c1ccc2c(c1)N=CCN2 |
| InChI | InChI=1S/C11H14N2/c1-8(2)9-3-4-10-11(7-9)13-6-5-12-10/h3-4,6-8,12H,5H2,1-2H3 |
| InChIKey | AWSFLOQOJNTHFR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |