About 5-propan-2-yl-2,3-dihydro-1,3-benzothiazole
5-propan-2-yl-2,3-dihydro-1,3-benzothiazole (PubChem CID 146691583) has the molecular formula C10H13NS
and a molecular weight of 179.29 g/mol. Its IUPAC name is 5-propan-2-yl-2,3-dihydro-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5-propan-2-yl-2,3-dihydro-1,3-benzothiazole |
| PubChem CID | 146691583 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 5-propan-2-yl-2,3-dihydro-1,3-benzothiazole |
| SMILES | CC(C)c1ccc2c(c1)NCS2 |
| InChI | InChI=1S/C10H13NS/c1-7(2)8-3-4-10-9(5-8)11-6-12-10/h3-5,7,11H,6H2,1-2H3 |
| InChIKey | QISMMBYMSCVAEU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-propan-2-yl-2,3-dihydro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-2,3-dihydro-1,3-benzothiazole?
The IUPAC name of 5-propan-2-yl-2,3-dihydro-1,3-benzothiazole (CID 146691583) is 5-propan-2-yl-2,3-dihydro-1,3-benzothiazole.
What is the SMILES notation for 5-propan-2-yl-2,3-dihydro-1,3-benzothiazole?
The canonical SMILES for 5-propan-2-yl-2,3-dihydro-1,3-benzothiazole is CC(C)c1ccc2c(c1)NCS2.
What is the InChIKey of 5-propan-2-yl-2,3-dihydro-1,3-benzothiazole?
The InChIKey is QISMMBYMSCVAEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NS/c1-7(2)8-3-4-10-9(5-8)11-6-12-10/h3-5,7,11H,6H2,1-2H3.
What are the key properties of 5-propan-2-yl-2,3-dihydro-1,3-benzothiazole?
5-propan-2-yl-2,3-dihydro-1,3-benzothiazole has a molecular weight of 179.29 g/mol, XLogP of 3.29, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-2,3-dihydro-1,3-benzothiazole is sourced from PubChem (CID 146691583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).