C10H13NS — CID 146691583
5-propan-2-yl-2,3-dihydro-1,3-benzothiazole (PubChem CID 146691583) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is 5-propan-2-yl-2,3-dihydro-1,3-benzothiazole.
| Compound Name | 5-propan-2-yl-2,3-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 146691583 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 5-propan-2-yl-2,3-dihydro-1,3-benzothiazole |
| SMILES | CC(C)c1ccc2c(c1)NCS2 |
| InChI | InChI=1S/C10H13NS/c1-7(2)8-3-4-10-9(5-8)11-6-12-10/h3-5,7,11H,6H2,1-2H3 |
| InChIKey | QISMMBYMSCVAEU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |