C11H16N2 — CID 162748632
3-methyl-5-propan-2-yl-1,2-dihydrobenzimidazole (PubChem CID 162748632) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-methyl-5-propan-2-yl-1,2-dihydrobenzimidazole.
| Compound Name | 3-methyl-5-propan-2-yl-1,2-dihydrobenzimidazole |
|---|---|
| PubChem CID | 162748632 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 3-methyl-5-propan-2-yl-1,2-dihydrobenzimidazole |
| SMILES | CC(C)c1ccc2c(c1)N(C)CN2 |
| InChI | InChI=1S/C11H16N2/c1-8(2)9-4-5-10-11(6-9)13(3)7-12-10/h4-6,8,12H,7H2,1-3H3 |
| InChIKey | KWWBBANKTXDDJM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |