C9H11NS — CID 143195772
2,3-dihydro-1,3-benzothiazole;ethene (PubChem CID 143195772) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 2,3-dihydro-1,3-benzothiazole;ethene.
| Compound Name | 2,3-dihydro-1,3-benzothiazole;ethene |
|---|---|
| PubChem CID | 143195772 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 2,3-dihydro-1,3-benzothiazole;ethene |
| SMILES | C=C.c1ccc2c(c1)NCS2 |
| InChI | InChI=1S/C7H7NS.C2H4/c1-2-4-7-6(3-1)8-5-9-7;1-2/h1-4,8H,5H2;1-2H2 |
| InChIKey | PGVCUSHGUZMQRK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|