C8H10NPS — CID 143467783
2,3-dihydro-1,3-benzothiazol-6-ylmethylphosphane (PubChem CID 143467783) has the molecular formula C8H10NPS and a molecular weight of 183.22 g/mol. Its IUPAC name is 2,3-dihydro-1,3-benzothiazol-6-ylmethylphosphane.
| Compound Name | 2,3-dihydro-1,3-benzothiazol-6-ylmethylphosphane |
|---|---|
| PubChem CID | 143467783 |
| Molecular Formula | C8H10NPS |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.03 |
| IUPAC Name | 2,3-dihydro-1,3-benzothiazol-6-ylmethylphosphane |
| SMILES | PCc1ccc2c(c1)SCN2 |
| InChI | InChI=1S/C8H10NPS/c10-4-6-1-2-7-8(3-6)11-5-9-7/h1-3,9H,4-5,10H2 |
| InChIKey | QLNOOONCZZGPEY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|