C8H9NS — CID 22342374
5-methyl-2,3-dihydro-1,3-benzothiazole (PubChem CID 22342374) has the molecular formula C8H9NS and a molecular weight of 151.23 g/mol. Its IUPAC name is 5-methyl-2,3-dihydro-1,3-benzothiazole.
| Compound Name | 5-methyl-2,3-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 22342374 |
| Molecular Formula | C8H9NS |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 5-methyl-2,3-dihydro-1,3-benzothiazole |
| SMILES | Cc1ccc2c(c1)NCS2 |
| InChI | InChI=1S/C8H9NS/c1-6-2-3-8-7(4-6)9-5-10-8/h2-4,9H,5H2,1H3 |
| InChIKey | YOCNSWXEHXJBSF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |