C10H13NS3 — CID 163183529
4,5,7,8-tetrahydro-1,3,6,8-benzotrithiazecine (PubChem CID 163183529) has the molecular formula C10H13NS3 and a molecular weight of 243.42 g/mol. Its IUPAC name is 4,5,7,8-tetrahydro-1,3,6,8-benzotrithiazecine.
| Compound Name | 4,5,7,8-tetrahydro-1,3,6,8-benzotrithiazecine |
|---|---|
| PubChem CID | 163183529 |
| Molecular Formula | C10H13NS3 |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 4,5,7,8-tetrahydro-1,3,6,8-benzotrithiazecine |
| SMILES | c1ccc2c(c1)NCSCCSCS2 |
| InChI | InChI=1S/C10H13NS3/c1-2-4-10-9(3-1)11-7-12-5-6-13-8-14-10/h1-4,11H,5-8H2 |
| InChIKey | VETQMALNGUUJIG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |