C11H17NOS — CID 144540149
4H-1,4-benzothiazin-3-one;molecular hydrogen;propane (PubChem CID 144540149) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is 4H-1,4-benzothiazin-3-one;molecular hydrogen;propane.
| Compound Name | 4H-1,4-benzothiazin-3-one;molecular hydrogen;propane |
|---|---|
| PubChem CID | 144540149 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 4H-1,4-benzothiazin-3-one;molecular hydrogen;propane |
| SMILES | CCC.O=C1CSc2ccccc2N1.[H][H] |
| InChI | InChI=1S/C8H7NOS.C3H8.H2/c10-8-5-11-7-4-2-1-3-6(7)9-8;1-3-2;/h1-4H,5H2,(H,9,10);3H2,1-2H3;1H |
| InChIKey | DSRJSLDTKBHDRJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |