C15H11NO2S — CID 11958353
6-benzoyl-4H-1,4-benzothiazin-3-one (PubChem CID 11958353) has the molecular formula C15H11NO2S and a molecular weight of 269.32 g/mol. Its IUPAC name is 6-benzoyl-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-benzoyl-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 11958353 |
| Molecular Formula | C15H11NO2S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 6-benzoyl-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2ccc(C(=O)c3ccccc3)cc2N1 |
| InChI | InChI=1S/C15H11NO2S/c17-14-9-19-13-7-6-11(8-12(13)16-14)15(18)10-4-2-1-3-5-10/h1-8H,9H2,(H,16,17) |
| InChIKey | JWEWZIJPKPACMC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |