C12H12ClNO2S — CID 15590122
6-(4-chlorobutanoyl)-4H-1,4-benzothiazin-3-one (PubChem CID 15590122) has the molecular formula C12H12ClNO2S and a molecular weight of 269.75 g/mol. Its IUPAC name is 6-(4-chlorobutanoyl)-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-(4-chlorobutanoyl)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 15590122 |
| Molecular Formula | C12H12ClNO2S |
| Molecular Weight | 269.75 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 6-(4-chlorobutanoyl)-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2ccc(C(=O)CCCCl)cc2N1 |
| InChI | InChI=1S/C12H12ClNO2S/c13-5-1-2-10(15)8-3-4-11-9(6-8)14-12(16)7-17-11/h3-4,6H,1-2,5,7H2,(H,14,16) |
| InChIKey | BGZSNJJPEKWOFY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.75 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|