C13H16N2O2S — CID 20967217
N,N-diethyl-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 20967217) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is N,N-diethyl-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | N,N-diethyl-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 20967217 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N,N-diethyl-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C13H16N2O2S/c1-3-15(4-2)13(17)9-5-6-11-10(7-9)14-12(16)8-18-11/h5-7H,3-4,8H2,1-2H3,(H,14,16) |
| InChIKey | PPMKKLRPHNDRKM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |