C9H8BrNOS — CID 116998901
7-(bromomethyl)-4H-1,4-benzothiazin-3-one (PubChem CID 116998901) has the molecular formula C9H8BrNOS and a molecular weight of 258.14 g/mol. Its IUPAC name is 7-(bromomethyl)-4H-1,4-benzothiazin-3-one.
| Compound Name | 7-(bromomethyl)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 116998901 |
| Molecular Formula | C9H8BrNOS |
| Molecular Weight | 258.14 g/mol |
| Exact Mass | 256.95 |
| IUPAC Name | 7-(bromomethyl)-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2cc(CBr)ccc2N1 |
| InChI | InChI=1S/C9H8BrNOS/c10-4-6-1-2-7-8(3-6)13-5-9(12)11-7/h1-3H,4-5H2,(H,11,12) |
| InChIKey | GXHNJXUYQXKKGU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.14 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|