C12H17NS — CID 143347469
3-ethyl-3-methyl-4,5-dihydro-2H-1,5-benzothiazepine (PubChem CID 143347469) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is 3-ethyl-3-methyl-4,5-dihydro-2H-1,5-benzothiazepine.
| Compound Name | 3-ethyl-3-methyl-4,5-dihydro-2H-1,5-benzothiazepine |
|---|---|
| PubChem CID | 143347469 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 3-ethyl-3-methyl-4,5-dihydro-2H-1,5-benzothiazepine |
| SMILES | CCC1(C)CNc2ccccc2SC1 |
| InChI | InChI=1S/C12H17NS/c1-3-12(2)8-13-10-6-4-5-7-11(10)14-9-12/h4-7,13H,3,8-9H2,1-2H3 |
| InChIKey | KJCRXIGPOCLKOZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |