C16H17NS — CID 13293497
2-benzyl-2-methyl-3,4-dihydro-1,4-benzothiazine (PubChem CID 13293497) has the molecular formula C16H17NS and a molecular weight of 255.39 g/mol. Its IUPAC name is 2-benzyl-2-methyl-3,4-dihydro-1,4-benzothiazine.
| Compound Name | 2-benzyl-2-methyl-3,4-dihydro-1,4-benzothiazine |
|---|---|
| PubChem CID | 13293497 |
| Molecular Formula | C16H17NS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-benzyl-2-methyl-3,4-dihydro-1,4-benzothiazine |
| SMILES | CC1(Cc2ccccc2)CNc2ccccc2S1 |
| InChI | InChI=1S/C16H17NS/c1-16(11-13-7-3-2-4-8-13)12-17-14-9-5-6-10-15(14)18-16/h2-10,17H,11-12H2,1H3 |
| InChIKey | CRWPRUGTZDQJSU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |