C14H14N2S — CID 154486612
2-benzyl-3,4-dihydro-1,2,4-benzothiadiazine (PubChem CID 154486612) has the molecular formula C14H14N2S and a molecular weight of 242.35 g/mol. Its IUPAC name is 2-benzyl-3,4-dihydro-1,2,4-benzothiadiazine.
| Compound Name | 2-benzyl-3,4-dihydro-1,2,4-benzothiadiazine |
|---|---|
| PubChem CID | 154486612 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-benzyl-3,4-dihydro-1,2,4-benzothiadiazine |
| SMILES | c1ccc(CN2CNc3ccccc3S2)cc1 |
| InChI | InChI=1S/C14H14N2S/c1-2-6-12(7-3-1)10-16-11-15-13-8-4-5-9-14(13)17-16/h1-9,15H,10-11H2 |
| InChIKey | ZXGKPJINLBFVNR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|