C14H11Cl3N2S — CID 54029505
6,8-dichloro-2-[(2-chlorophenyl)methyl]-3,4-dihydro-1,2,4-benzothiadiazine (PubChem CID 54029505) has the molecular formula C14H11Cl3N2S and a molecular weight of 345.68 g/mol. Its IUPAC name is 6,8-dichloro-2-[(2-chlorophenyl)methyl]-3,4-dihydro-1,2,4-benzothiadiazine.
| Compound Name | 6,8-dichloro-2-[(2-chlorophenyl)methyl]-3,4-dihydro-1,2,4-benzothiadiazine |
|---|---|
| PubChem CID | 54029505 |
| Molecular Formula | C14H11Cl3N2S |
| Molecular Weight | 345.68 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 6,8-dichloro-2-[(2-chlorophenyl)methyl]-3,4-dihydro-1,2,4-benzothiadiazine |
| SMILES | Clc1cc(Cl)c2c(c1)NCN(Cc1ccccc1Cl)S2 |
| InChI | InChI=1S/C14H11Cl3N2S/c15-10-5-12(17)14-13(6-10)18-8-19(20-14)7-9-3-1-2-4-11(9)16/h1-6,18H,7-8H2 |
| InChIKey | LEOHJWIYQVAIEF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.68 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|