About 2-benzyl-1,2-benzothiazine
2-benzyl-1,2-benzothiazine (PubChem CID 154184832) has the molecular formula C15H13NS
and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-benzyl-1,2-benzothiazine.
Molecular Properties
| Compound Name | 2-benzyl-1,2-benzothiazine |
| PubChem CID | 154184832 |
| Molecular Formula | C15H13NS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-benzyl-1,2-benzothiazine |
| SMILES | C1=CN(Cc2ccccc2)Sc2ccccc21 |
| InChI | InChI=1S/C15H13NS/c1-2-6-13(7-3-1)12-16-11-10-14-8-4-5-9-15(14)17-16/h1-11H,12H2 |
| InChIKey | JSZPDZKGUIQFPF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-1,2-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1,2-benzothiazine?
The IUPAC name of 2-benzyl-1,2-benzothiazine (CID 154184832) is 2-benzyl-1,2-benzothiazine.
What is the SMILES notation for 2-benzyl-1,2-benzothiazine?
The canonical SMILES for 2-benzyl-1,2-benzothiazine is C1=CN(Cc2ccccc2)Sc2ccccc21.
What is the InChIKey of 2-benzyl-1,2-benzothiazine?
The InChIKey is JSZPDZKGUIQFPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NS/c1-2-6-13(7-3-1)12-16-11-10-14-8-4-5-9-15(14)17-16/h1-11H,12H2.
What are the key properties of 2-benzyl-1,2-benzothiazine?
2-benzyl-1,2-benzothiazine has a molecular weight of 239.34 g/mol, XLogP of 4.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1,2-benzothiazine is sourced from PubChem (CID 154184832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).