C17H17AuClN2- — CID 54576759
1,3-dibenzyl-2H-imidazol-2-ide;gold(1+);chloride (PubChem CID 54576759) has the molecular formula C17H17AuClN2- and a molecular weight of 481.76 g/mol. Its IUPAC name is 1,3-dibenzyl-2H-imidazol-2-ide;gold(1+);chloride.
| Compound Name | 1,3-dibenzyl-2H-imidazol-2-ide;gold(1+);chloride |
|---|---|
| PubChem CID | 54576759 |
| Molecular Formula | C17H17AuClN2- |
| Molecular Weight | 481.76 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 1,3-dibenzyl-2H-imidazol-2-ide;gold(1+);chloride |
| SMILES | C1=CN(Cc2ccccc2)[CH-]N1Cc1ccccc1.[Au+].[Cl-] |
| InChI | InChI=1S/C17H17N2.Au.ClH/c1-3-7-16(8-4-1)13-18-11-12-19(15-18)14-17-9-5-2-6-10-17;;/h1-12,15H,13-14H2;;1H/q-1;+1;/p-1 |
| InChIKey | PMJXESSRGUJOPJ-UHFFFAOYSA-M |
| XLogP | 0.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.76 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|