About 1-benzyl-2-iodopyrrole
1-benzyl-2-iodopyrrole (PubChem CID 139840262) has the molecular formula C11H10IN
and a molecular weight of 283.11 g/mol. Its IUPAC name is 1-benzyl-2-iodopyrrole.
Molecular Properties
| Compound Name | 1-benzyl-2-iodopyrrole |
| PubChem CID | 139840262 |
| Molecular Formula | C11H10IN |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 1-benzyl-2-iodopyrrole |
| SMILES | Ic1cccn1Cc1ccccc1 |
| InChI | InChI=1S/C11H10IN/c12-11-7-4-8-13(11)9-10-5-2-1-3-6-10/h1-8H,9H2 |
| InChIKey | PACQGPGQVXRGKW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-2-iodopyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-iodopyrrole?
The IUPAC name of 1-benzyl-2-iodopyrrole (CID 139840262) is 1-benzyl-2-iodopyrrole.
What is the SMILES notation for 1-benzyl-2-iodopyrrole?
The canonical SMILES for 1-benzyl-2-iodopyrrole is Ic1cccn1Cc1ccccc1.
What is the InChIKey of 1-benzyl-2-iodopyrrole?
The InChIKey is PACQGPGQVXRGKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10IN/c12-11-7-4-8-13(11)9-10-5-2-1-3-6-10/h1-8H,9H2.
What are the key properties of 1-benzyl-2-iodopyrrole?
1-benzyl-2-iodopyrrole has a molecular weight of 283.11 g/mol, XLogP of 3.14, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-iodopyrrole is sourced from PubChem (CID 139840262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).