About 1,2-dibenzylpyrrole
1,2-dibenzylpyrrole (PubChem CID 15912413) has the molecular formula C18H17N
and a molecular weight of 247.34 g/mol. Its IUPAC name is 1,2-dibenzylpyrrole.
Molecular Properties
| Compound Name | 1,2-dibenzylpyrrole |
| PubChem CID | 15912413 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 1,2-dibenzylpyrrole |
| SMILES | c1ccc(Cc2cccn2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H17N/c1-3-8-16(9-4-1)14-18-12-7-13-19(18)15-17-10-5-2-6-11-17/h1-13H,14-15H2 |
| InChIKey | NPKYWBCZRJYRHW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-dibenzylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dibenzylpyrrole?
The IUPAC name of 1,2-dibenzylpyrrole (CID 15912413) is 1,2-dibenzylpyrrole.
What is the SMILES notation for 1,2-dibenzylpyrrole?
The canonical SMILES for 1,2-dibenzylpyrrole is c1ccc(Cc2cccn2Cc2ccccc2)cc1.
What is the InChIKey of 1,2-dibenzylpyrrole?
The InChIKey is NPKYWBCZRJYRHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N/c1-3-8-16(9-4-1)14-18-12-7-13-19(18)15-17-10-5-2-6-11-17/h1-13H,14-15H2.
What are the key properties of 1,2-dibenzylpyrrole?
1,2-dibenzylpyrrole has a molecular weight of 247.34 g/mol, XLogP of 4.13, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dibenzylpyrrole is sourced from PubChem (CID 15912413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).