About 1-benzyl-2-heptylpyrrole
1-benzyl-2-heptylpyrrole (PubChem CID 102411152) has the molecular formula C18H25N
and a molecular weight of 255.41 g/mol. Its IUPAC name is 1-benzyl-2-heptylpyrrole.
Molecular Properties
| Compound Name | 1-benzyl-2-heptylpyrrole |
| PubChem CID | 102411152 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 1-benzyl-2-heptylpyrrole |
| SMILES | CCCCCCCc1cccn1Cc1ccccc1 |
| InChI | InChI=1S/C18H25N/c1-2-3-4-5-9-13-18-14-10-15-19(18)16-17-11-7-6-8-12-17/h6-8,10-12,14-15H,2-5,9,13,16H2,1H3 |
| InChIKey | VDODAIYCKBEIDD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-2-heptylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-heptylpyrrole?
The IUPAC name of 1-benzyl-2-heptylpyrrole (CID 102411152) is 1-benzyl-2-heptylpyrrole.
What is the SMILES notation for 1-benzyl-2-heptylpyrrole?
The canonical SMILES for 1-benzyl-2-heptylpyrrole is CCCCCCCc1cccn1Cc1ccccc1.
What is the InChIKey of 1-benzyl-2-heptylpyrrole?
The InChIKey is VDODAIYCKBEIDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N/c1-2-3-4-5-9-13-18-14-10-15-19(18)16-17-11-7-6-8-12-17/h6-8,10-12,14-15H,2-5,9,13,16H2,1H3.
What are the key properties of 1-benzyl-2-heptylpyrrole?
1-benzyl-2-heptylpyrrole has a molecular weight of 255.41 g/mol, XLogP of 5.05, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-heptylpyrrole is sourced from PubChem (CID 102411152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).