About 1-octyl-2-propylpyrrole
1-octyl-2-propylpyrrole (PubChem CID 171570532) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is 1-octyl-2-propylpyrrole.
Molecular Properties
| Compound Name | 1-octyl-2-propylpyrrole |
| PubChem CID | 171570532 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 1-octyl-2-propylpyrrole |
| SMILES | CCCCCCCCn1cccc1CCC |
| InChI | InChI=1S/C15H27N/c1-3-5-6-7-8-9-13-16-14-10-12-15(16)11-4-2/h10,12,14H,3-9,11,13H2,1-2H3 |
| InChIKey | IASRDYQPVICEDF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-octyl-2-propylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-octyl-2-propylpyrrole?
The IUPAC name of 1-octyl-2-propylpyrrole (CID 171570532) is 1-octyl-2-propylpyrrole.
What is the SMILES notation for 1-octyl-2-propylpyrrole?
The canonical SMILES for 1-octyl-2-propylpyrrole is CCCCCCCCn1cccc1CCC.
What is the InChIKey of 1-octyl-2-propylpyrrole?
The InChIKey is IASRDYQPVICEDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N/c1-3-5-6-7-8-9-13-16-14-10-12-15(16)11-4-2/h10,12,14H,3-9,11,13H2,1-2H3.
What are the key properties of 1-octyl-2-propylpyrrole?
1-octyl-2-propylpyrrole has a molecular weight of 221.39 g/mol, XLogP of 4.80, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-octyl-2-propylpyrrole is sourced from PubChem (CID 171570532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).