About 1-dodecyl-2-ethylpyrrole;hydrochloride
1-dodecyl-2-ethylpyrrole;hydrochloride (PubChem CID 175874799) has the molecular formula C18H34ClN
and a molecular weight of 299.93 g/mol. Its IUPAC name is 1-dodecyl-2-ethylpyrrole;hydrochloride.
Molecular Properties
| Compound Name | 1-dodecyl-2-ethylpyrrole;hydrochloride |
| PubChem CID | 175874799 |
| Molecular Formula | C18H34ClN |
| Molecular Weight | 299.93 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 1-dodecyl-2-ethylpyrrole;hydrochloride |
| SMILES | CCCCCCCCCCCCn1cccc1CC.Cl |
| InChI | InChI=1S/C18H33N.ClH/c1-3-5-6-7-8-9-10-11-12-13-16-19-17-14-15-18(19)4-2;/h14-15,17H,3-13,16H2,1-2H3;1H |
| InChIKey | MLWRRCVJEFPIGI-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.93 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-dodecyl-2-ethylpyrrole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dodecyl-2-ethylpyrrole;hydrochloride?
The IUPAC name of 1-dodecyl-2-ethylpyrrole;hydrochloride (CID 175874799) is 1-dodecyl-2-ethylpyrrole;hydrochloride.
What is the SMILES notation for 1-dodecyl-2-ethylpyrrole;hydrochloride?
The canonical SMILES for 1-dodecyl-2-ethylpyrrole;hydrochloride is CCCCCCCCCCCCn1cccc1CC.Cl.
What is the InChIKey of 1-dodecyl-2-ethylpyrrole;hydrochloride?
The InChIKey is MLWRRCVJEFPIGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33N.ClH/c1-3-5-6-7-8-9-10-11-12-13-16-19-17-14-15-18(19)4-2;/h14-15,17H,3-13,16H2,1-2H3;1H.
What are the key properties of 1-dodecyl-2-ethylpyrrole;hydrochloride?
1-dodecyl-2-ethylpyrrole;hydrochloride has a molecular weight of 299.93 g/mol, XLogP of 6.39, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dodecyl-2-ethylpyrrole;hydrochloride is sourced from PubChem (CID 175874799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).