C20H36F3NO3S — CID 175874765
1-dodecyl-2-propylpyrrole;trifluoromethanesulfonic acid (PubChem CID 175874765) has the molecular formula C20H36F3NO3S and a molecular weight of 427.57 g/mol. Its IUPAC name is 1-dodecyl-2-propylpyrrole;trifluoromethanesulfonic acid.
| Compound Name | 1-dodecyl-2-propylpyrrole;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 175874765 |
| Molecular Formula | C20H36F3NO3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 1-dodecyl-2-propylpyrrole;trifluoromethanesulfonic acid |
| SMILES | CCCCCCCCCCCCn1cccc1CCC.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C19H35N.CHF3O3S/c1-3-5-6-7-8-9-10-11-12-13-17-20-18-14-16-19(20)15-4-2;2-1(3,4)8(5,6)7/h14,16,18H,3-13,15,17H2,1-2H3;(H,5,6,7) |
| InChIKey | HOBUEQQHJLKRSG-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|