C18H32F3NO3S — CID 175875008
3-butyl-1-nonylpyrrole;trifluoromethanesulfonic acid (PubChem CID 175875008) has the molecular formula C18H32F3NO3S and a molecular weight of 399.52 g/mol. Its IUPAC name is 3-butyl-1-nonylpyrrole;trifluoromethanesulfonic acid.
| Compound Name | 3-butyl-1-nonylpyrrole;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 175875008 |
| Molecular Formula | C18H32F3NO3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 3-butyl-1-nonylpyrrole;trifluoromethanesulfonic acid |
| SMILES | CCCCCCCCCn1ccc(CCCC)c1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C17H31N.CHF3O3S/c1-3-5-7-8-9-10-11-14-18-15-13-17(16-18)12-6-4-2;2-1(3,4)8(5,6)7/h13,15-16H,3-12,14H2,1-2H3;(H,5,6,7) |
| InChIKey | BVHKQICPUAWFPN-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|