C13H25NO3S — CID 175874652
methanesulfonic acid;1-pentyl-3-propylpyrrole (PubChem CID 175874652) has the molecular formula C13H25NO3S and a molecular weight of 275.41 g/mol. Its IUPAC name is methanesulfonic acid;1-pentyl-3-propylpyrrole.
| Compound Name | methanesulfonic acid;1-pentyl-3-propylpyrrole |
|---|---|
| PubChem CID | 175874652 |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | methanesulfonic acid;1-pentyl-3-propylpyrrole |
| SMILES | CCCCCn1ccc(CCC)c1.CS(=O)(=O)O |
| InChI | InChI=1S/C12H21N.CH4O3S/c1-3-5-6-9-13-10-8-12(11-13)7-4-2;1-5(2,3)4/h8,10-11H,3-7,9H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | BJTWZPRHFILQAA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|