About 1,3-dibutylpyrrole;hydrochloride
1,3-dibutylpyrrole;hydrochloride (PubChem CID 175874933) has the molecular formula C12H22ClN
and a molecular weight of 215.77 g/mol. Its IUPAC name is 1,3-dibutylpyrrole;hydrochloride.
Molecular Properties
| Compound Name | 1,3-dibutylpyrrole;hydrochloride |
| PubChem CID | 175874933 |
| Molecular Formula | C12H22ClN |
| Molecular Weight | 215.77 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 1,3-dibutylpyrrole;hydrochloride |
| SMILES | CCCCc1ccn(CCCC)c1.Cl |
| InChI | InChI=1S/C12H21N.ClH/c1-3-5-7-12-8-10-13(11-12)9-6-4-2;/h8,10-11H,3-7,9H2,1-2H3;1H |
| InChIKey | ZHTXWSKUNHTDPB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.77 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-dibutylpyrrole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibutylpyrrole;hydrochloride?
The IUPAC name of 1,3-dibutylpyrrole;hydrochloride (CID 175874933) is 1,3-dibutylpyrrole;hydrochloride.
What is the SMILES notation for 1,3-dibutylpyrrole;hydrochloride?
The canonical SMILES for 1,3-dibutylpyrrole;hydrochloride is CCCCc1ccn(CCCC)c1.Cl.
What is the InChIKey of 1,3-dibutylpyrrole;hydrochloride?
The InChIKey is ZHTXWSKUNHTDPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N.ClH/c1-3-5-7-12-8-10-13(11-12)9-6-4-2;/h8,10-11H,3-7,9H2,1-2H3;1H.
What are the key properties of 1,3-dibutylpyrrole;hydrochloride?
1,3-dibutylpyrrole;hydrochloride has a molecular weight of 215.77 g/mol, XLogP of 4.05, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibutylpyrrole;hydrochloride is sourced from PubChem (CID 175874933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).