C12H22ClN — CID 175874933
1,3-dibutylpyrrole;hydrochloride (PubChem CID 175874933) has the molecular formula C12H22ClN and a molecular weight of 215.77 g/mol. Its IUPAC name is 1,3-dibutylpyrrole;hydrochloride.
| Compound Name | 1,3-dibutylpyrrole;hydrochloride |
|---|---|
| PubChem CID | 175874933 |
| Molecular Formula | C12H22ClN |
| Molecular Weight | 215.77 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 1,3-dibutylpyrrole;hydrochloride |
| SMILES | CCCCc1ccn(CCCC)c1.Cl |
| InChI | InChI=1S/C12H21N.ClH/c1-3-5-7-12-8-10-13(11-12)9-6-4-2;/h8,10-11H,3-7,9H2,1-2H3;1H |
| InChIKey | ZHTXWSKUNHTDPB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.77 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |