About 3-dodecyl-1-ethylpyrrole
3-dodecyl-1-ethylpyrrole (PubChem CID 66960014) has the molecular formula C18H33N
and a molecular weight of 263.47 g/mol. Its IUPAC name is 3-dodecyl-1-ethylpyrrole.
Molecular Properties
| Compound Name | 3-dodecyl-1-ethylpyrrole |
| PubChem CID | 66960014 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | 3-dodecyl-1-ethylpyrrole |
| SMILES | CCCCCCCCCCCCc1ccn(CC)c1 |
| InChI | InChI=1S/C18H33N/c1-3-5-6-7-8-9-10-11-12-13-14-18-15-16-19(4-2)17-18/h15-17H,3-14H2,1-2H3 |
| InChIKey | NBQWWKHLFUKXRZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-dodecyl-1-ethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dodecyl-1-ethylpyrrole?
The IUPAC name of 3-dodecyl-1-ethylpyrrole (CID 66960014) is 3-dodecyl-1-ethylpyrrole.
What is the SMILES notation for 3-dodecyl-1-ethylpyrrole?
The canonical SMILES for 3-dodecyl-1-ethylpyrrole is CCCCCCCCCCCCc1ccn(CC)c1.
What is the InChIKey of 3-dodecyl-1-ethylpyrrole?
The InChIKey is NBQWWKHLFUKXRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33N/c1-3-5-6-7-8-9-10-11-12-13-14-18-15-16-19(4-2)17-18/h15-17H,3-14H2,1-2H3.
What are the key properties of 3-dodecyl-1-ethylpyrrole?
3-dodecyl-1-ethylpyrrole has a molecular weight of 263.47 g/mol, XLogP of 5.97, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dodecyl-1-ethylpyrrole is sourced from PubChem (CID 66960014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).