About 3-pentyl-1-phenylpyrrole
3-pentyl-1-phenylpyrrole (PubChem CID 177458956) has the molecular formula C15H19N
and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-pentyl-1-phenylpyrrole.
Molecular Properties
| Compound Name | 3-pentyl-1-phenylpyrrole |
| PubChem CID | 177458956 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 3-pentyl-1-phenylpyrrole |
| SMILES | CCCCCc1ccn(-c2ccccc2)c1 |
| InChI | InChI=1S/C15H19N/c1-2-3-5-8-14-11-12-16(13-14)15-9-6-4-7-10-15/h4,6-7,9-13H,2-3,5,8H2,1H3 |
| InChIKey | FQQMXXAELOQPKA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pentyl-1-phenylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentyl-1-phenylpyrrole?
The IUPAC name of 3-pentyl-1-phenylpyrrole (CID 177458956) is 3-pentyl-1-phenylpyrrole.
What is the SMILES notation for 3-pentyl-1-phenylpyrrole?
The canonical SMILES for 3-pentyl-1-phenylpyrrole is CCCCCc1ccn(-c2ccccc2)c1.
What is the InChIKey of 3-pentyl-1-phenylpyrrole?
The InChIKey is FQQMXXAELOQPKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N/c1-2-3-5-8-14-11-12-16(13-14)15-9-6-4-7-10-15/h4,6-7,9-13H,2-3,5,8H2,1H3.
What are the key properties of 3-pentyl-1-phenylpyrrole?
3-pentyl-1-phenylpyrrole has a molecular weight of 213.32 g/mol, XLogP of 4.21, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentyl-1-phenylpyrrole is sourced from PubChem (CID 177458956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).